cas: 958245-18-6 — see every product listed under this CAS number, including other names
3-Methoxy-4-(4-methyl-1H-imidazol-1-yl)aniline 98% (CAS 958245-18-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A708730-100mg |
| cas | 958245-18-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 542.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A708730 |
3-methoxy-4-(4-methylimidazol-1-yl)aniline (CAS 958245-18-6) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 3-methoxy-4-(4-methylimidazol-1-yl)aniline. InChIKey: JLIBQHGPJWSTQL-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 3-methoxy-4-(4-methylimidazol-1-yl)aniline |
| InChIKey | JLIBQHGPJWSTQL-UHFFFAOYSA-N |
| SMILES | CC1=CN(C=N1)C2=C(C=C(C=C2)N)OC |
Computed by PubChem (NCBI)