Products 900513-14-6
CAS 900513-14-6 is the registry number for 6-Amino-3-isopropylquinazolin-4(3h)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-amino-3-propan-2-ylquinazolin-4-one (CAS 900513-14-6) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 6-amino-3-propan-2-ylquinazolin-4-one. InChIKey: DFLMREXNJDPURX-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 6-amino-3-propan-2-ylquinazolin-4-one |
| InChIKey | DFLMREXNJDPURX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C(C1=O)C=C(C=C2)N |
Computed by PubChem (NCBI)