CAS 1045861-07-1 is the registry number for N-(5-Cyano-pyridin-2-yl)-2,2-dimethyl-propionamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
N-(5-cyano-2-pyridinyl)-2,2-dimethylpropanamide (CAS 1045861-07-1) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: N-(5-cyano-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: VKBUZEJNXFACJG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | N-(5-cyano-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | VKBUZEJNXFACJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)C#N |
Computed by PubChem (NCBI)