CAS 419550-79-1 appears in our catalog under these names: 3-Amino-4-(4-methoxy phenyl)-5-methyl pyrazole, 95%, 4-(4-Methoxyphenyl)-3-methyl-1h-pyrazol-5-amine, 95%, 4-(4-Methoxyphenyl)-5-methyl-1H-pyrazol-3-amine, 98%, 4-(4-Methoxyphenyl)-5-methyl-1H-pyrazol-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg, 0,5g.
4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine (CAS 419550-79-1) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine. InChIKey: OGKYRTBDCGSONH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-5-methyl-1H-pyrazol-3-amine |
| InChIKey | OGKYRTBDCGSONH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)