CAS 91331-86-1 is the registry number for 1-(4-Methoxyphenyl)-3-methyl-1h-pyrazol-5-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(4-methoxyphenyl)-5-methylpyrazol-3-amine (CAS 91331-86-1) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-methylpyrazol-3-amine. InChIKey: YQSZHCXCUDINAM-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-methylpyrazol-3-amine |
| InChIKey | YQSZHCXCUDINAM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)