cas: 917757-15-4 — see every product listed under this CAS number, including other names
3-Methoxy-4-methylphenylboronic acid 98% (CAS 917757-15-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499234-5g |
| cas | 917757-15-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 10g | 476.06 Pln | |
| Ambeed | 25g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A499234 |
(3-methoxy-4-methylphenyl)boronic acid (CAS 917757-15-4) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (3-methoxy-4-methylphenyl)boronic acid. InChIKey: UMGAGEBOUIODFE-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (3-methoxy-4-methylphenyl)boronic acid |
| InChIKey | UMGAGEBOUIODFE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)OC)(O)O |
Computed by PubChem (NCBI)