cas: 917757-15-4 — see every product listed under this CAS number, including other names
Boronic acid, B-(3-methoxy-4-methylphenyl)-, 97%, 97% (CAS 917757-15-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117P3U-100mg |
| cas | 917757-15-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 395.60 Pln | |
| Chemat | 25g | 890.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-methoxy-4-methylphenyl)boronic acid (CAS 917757-15-4) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (3-methoxy-4-methylphenyl)boronic acid. InChIKey: UMGAGEBOUIODFE-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (3-methoxy-4-methylphenyl)boronic acid |
| InChIKey | UMGAGEBOUIODFE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)OC)(O)O |
Computed by PubChem (NCBI)