cas: 16292-88-9 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitroaniline 98% (CAS 16292-88-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218754-250mg |
| cas | 16292-88-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 10g | 748.62 Pln | |
| Ambeed | 25g | 1538.50 Pln | |
| Ambeed | 100g | 4469.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218754 |
3-methoxy-4-nitroaniline (CAS 16292-88-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3-methoxy-4-nitroaniline. InChIKey: JVUHWSGOORVDML-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-methoxy-4-nitroaniline |
| InChIKey | JVUHWSGOORVDML-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)