cas: 16292-88-9 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitroaniline, 98%, 98% (CAS 16292-88-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 100g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABHM-100mg |
| cas | 16292-88-9 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 400.40 Pln | |
| Chemat | 50g | 1576.40 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 250g | 4485.20 Pln | |
| Chemat | 500g | 6768.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-4-nitroaniline (CAS 16292-88-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3-methoxy-4-nitroaniline. InChIKey: JVUHWSGOORVDML-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-methoxy-4-nitroaniline |
| InChIKey | JVUHWSGOORVDML-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)