3-Methoxy-5-(trifluoromethyl)phenylboronic acid, 95%
cas: 871332-97-7 — see every product listed under this CAS number, including other names
3-Methoxy-5-(trifluoromethyl)phenylboronic acid, 95% (CAS 871332-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A125371-250mg |
| cas | 871332-97-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 25g | 1738.75 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 147.75 Pln | |
| BLDpharm | 5g | 447.64 Pln | |
| BLDpharm | 25g | 1869.37 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 789.32 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
[3-methoxy-5-(trifluoromethyl)phenyl]boronic acid (CAS 871332-97-7) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: GKEMDZIGTOAZRK-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | GKEMDZIGTOAZRK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methoxy-5-(trifluoromethyl)phenylboronic acid, [3-methoxy-5-(trifluoromethyl)phenyl]boronic acid, (3-methoxy-5-(trifluoromethyl)phenyl)boronic acid, Boronic acid, [3-methoxy-5-(trifluoromethyl)phenyl]-, 3-Methoxy-5-trifluoromethylbenzeneboronic acid, 3-Methoxy-5-(trifluoromethyl)phenylboronicacid