cas: 117860-55-6 — see every product listed under this CAS number, including other names
3-Methyl 1-methyl-1H-pyrazole-3,5-dicarboxylate, 98%, 98% (CAS 117860-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105Q0-100mg |
| cas | 117860-55-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3933.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid (CAS 117860-55-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid. InChIKey: JXXJEKYENYTLSX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid |
| InChIKey | JXXJEKYENYTLSX-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)