Products 128276-50-6
CAS 128276-50-6 appears in our catalog under these names: 4,6-Dimethoxypyrimidine-2-carboxylic acid, 95%, 4,6-Dimethoxypyrimidine-2-carboxylic acid 97%, 4，6-Dimethoxypyrimidine-2-carboxylic acid, 97%, 97%, 4,6-Dimethoxypyrimidine-2-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 25g.
4,6-dimethoxypyrimidine-2-carboxylic acid (CAS 128276-50-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 4,6-dimethoxypyrimidine-2-carboxylic acid. InChIKey: PRXXMEMJCXTHTP-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 4,6-dimethoxypyrimidine-2-carboxylic acid |
| InChIKey | PRXXMEMJCXTHTP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)C(=O)O)OC |
Computed by PubChem (NCBI)