CAS 117860-55-6 appears in our catalog under these names: 3-(Methoxycarbonyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%, 3-(Methoxycarbonyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 97%, 3–(Methoxycarbonyl)–1–methyl–1H–pyrazole–5–carboxylic acid, 3-(methoxycarbonyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 3-(Methoxycarbonyl)-1-methyl-1H-pyrazole-5-carboxylic acid 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 10g, 5g, 2g, 25g, 100mg.
3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid (CAS 117860-55-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid. InChIKey: JXXJEKYENYTLSX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-methoxycarbonyl-1-methylpyrazole-5-carboxylic acid |
| InChIKey | JXXJEKYENYTLSX-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)