cas: 1255717-75-9 — see every product listed under this CAS number, including other names
3-Methyl-1-phenylpiperazine hydrochloride, 98%, 98% (CAS 1255717-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J1XJ-100mg |
| cas | 1255717-75-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 1g | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methyl-1-phenylpiperazine;hydrochloride (CAS 1255717-75-9) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 3-methyl-1-phenylpiperazine;hydrochloride. InChIKey: JRDSJYMUTUZVAD-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 3-methyl-1-phenylpiperazine;hydrochloride |
| InChIKey | JRDSJYMUTUZVAD-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)