Products 52987-48-1

CAS 52987-48-1 is the registry number for 3-Methyl-1-phenylhexahydropyridazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-methyl-1-phenyldiazinane;hydrochloride (CAS 52987-48-1) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 3-methyl-1-phenyldiazinane;hydrochloride. InChIKey: IJIWBWMYXTUQJG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2
Molecular weight212.72 g/mol
IUPAC name3-methyl-1-phenyldiazinane;hydrochloride
InChIKeyIJIWBWMYXTUQJG-UHFFFAOYSA-N
SMILESCC1CCCN(N1)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)