CAS 133980-65-1 is the registry number for 6-Chloro-2,4-diisopropylpyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2,4-di(propan-2-yl)pyridin-3-amine (CAS 133980-65-1) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 6-chloro-2,4-di(propan-2-yl)pyridin-3-amine. InChIKey: ABKSYZFBMOLMGG-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 6-chloro-2,4-di(propan-2-yl)pyridin-3-amine |
| InChIKey | ABKSYZFBMOLMGG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=NC(=C1N)C(C)C)Cl |
Computed by PubChem (NCBI)