Products 866956-98-1

CAS 866956-98-1 is the registry number for 4-(Pyrrolidinomethyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-(pyrrolidin-1-ylmethyl)aniline;hydrochloride (CAS 866956-98-1) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-(pyrrolidin-1-ylmethyl)aniline;hydrochloride. InChIKey: FEAQNMHHJOVWQP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17ClN2
Molecular weight212.72 g/mol
IUPAC name4-(pyrrolidin-1-ylmethyl)aniline;hydrochloride
InChIKeyFEAQNMHHJOVWQP-UHFFFAOYSA-N
SMILESC1CCN(C1)CC2=CC=C(C=C2)N.Cl

Computed by PubChem (NCBI)