CAS 110475-33-7 appears in our catalog under these names: 4-Piperidinoaniline hydrochloride, 98%, 4-(Piperidin-1-yl)aniline hydrochloride, 98%, 4-Piperidin-1-yl-phenylamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 25g, 1g, 250mg, 2,5g, 0,25g.
4-piperidin-1-ylaniline;hydrochloride (CAS 110475-33-7) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-piperidin-1-ylaniline;hydrochloride. InChIKey: HYLYCYONEOJCCG-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 4-piperidin-1-ylaniline;hydrochloride |
| InChIKey | HYLYCYONEOJCCG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)