3-Methyl-4-[(methylsulfonyl)amino]benzoic acid, 95+%, 95+%
cas: 892878-60-3 — see every product listed under this CAS number, including other names
3-Methyl-4-[(methylsulfonyl)amino]benzoic acid, 95+%, 95+% (CAS 892878-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFMN-100mg |
| cas | 892878-60-3 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 3880.40 Pln | |
| Chemat | 10g | 6170.00 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-(methanesulfonamido)-3-methylbenzoic acid (CAS 892878-60-3) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 4-(methanesulfonamido)-3-methylbenzoic acid. InChIKey: ONJNQHFRVKPEAG-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-(methanesulfonamido)-3-methylbenzoic acid |
| InChIKey | ONJNQHFRVKPEAG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)NS(=O)(=O)C |
Computed by PubChem (NCBI)
Synonyms:
3-Methyl-4-(methylsulfonamido)benzoic acid, 4-(methanesulfonamido)-3-methylbenzoic acid, benzoic acid, 3-methyl-4-[(methylsulfonyl)amino]-, 3-Methyl-4-(methylsulfonyl)aminobenzoic Acid, 3-Methyl-4-(methylsulfonamido)benzoicacid, 4-methanesulfonamido-3-methylbenzoic acid, 4-(methanesulfonamido)-3-methyl-benzoic acid