cas: 261952-09-4 — see every product listed under this CAS number, including other names
3-Methyl-5-(trifluoromethyl)benzoyl chloride, 95+% (CAS 261952-09-4) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A962228-10g |
| cas | 261952-09-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6775.30 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-methyl-5-(trifluoromethyl)benzoyl chloride (CAS 261952-09-4) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 3-methyl-5-(trifluoromethyl)benzoyl chloride. InChIKey: STYLTOJEHPKJDF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 3-methyl-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | STYLTOJEHPKJDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(F)(F)F)C(=O)Cl |
Computed by PubChem (NCBI)