3-Nitro-4-pyridinecarboxylic acid
cas: 59290-82-3 — see every product listed under this CAS number, including other names
3-Nitro-4-pyridinecarboxylic acid (CAS 59290-82-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044368-100MG |
| cas | 59290-82-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 25g | 5381.46 Pln |
properties
| delivery time | 3-4 weeks |
|---|
3-nitropyridine-4-carboxylic acid (CAS 59290-82-3) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 3-nitropyridine-4-carboxylic acid. InChIKey: YKPIUHZVTZWEEW-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 3-nitropyridine-4-carboxylic acid |
| InChIKey | YKPIUHZVTZWEEW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)