cas: 645-09-0 — see every product listed under this CAS number, including other names
3-Nitrobenzamide, 98%, 98% (CAS 645-09-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JT4-5g |
| cas | 645-09-0 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 155.60 Pln | |
| Chemat | 100g | 434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-nitrobenzamide (CAS 645-09-0) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 3-nitrobenzamide. InChIKey: KWAYEPXDGHYGRW-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 3-nitrobenzamide |
| InChIKey | KWAYEPXDGHYGRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)