cas: 121-52-8 — see every product listed under this CAS number, including other names
3-Nitrobenzenesulfonamide, 95% (CAS 121-52-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078499-5G |
| cas | 121-52-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 25g | 154.13 Pln | |
| Fluorochem | 100g | 383.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-nitrobenzenesulfonamide (CAS 121-52-8) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 3-nitrobenzenesulfonamide. InChIKey: TXTQURPQLVHJRE-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 3-nitrobenzenesulfonamide |
| InChIKey | TXTQURPQLVHJRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)