cas: 121-90-4 — see every product listed under this CAS number, including other names
3-Nitrobenzoyl Chloride, >98.0%(GC)(T) (CAS 121-90-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0174-25G |
| cas | 121-90-4 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 213.26 Pln | |
| TCI | 500g | 1231.13 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-nitrobenzoyl chloride (CAS 121-90-4) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 3-nitrobenzoyl chloride. InChIKey: NXTNASSYJUXJDV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 3-nitrobenzoyl chloride |
| InChIKey | NXTNASSYJUXJDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)