cas: 102-38-5 — see every product listed under this CAS number, including other names
3-Nitroformanilide, 97%, 97% (CAS 102-38-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11179T-1g |
| cas | 102-38-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 698.00 Pln | |
| Chemat | 5g | 2363.60 Pln | |
| Chemat | 10g | 3861.20 Pln | |
| Chemat | 25g | 7211.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-(3-nitrophenyl)formamide (CAS 102-38-5) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: N-(3-nitrophenyl)formamide. InChIKey: QCDUUALALDXTAD-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | N-(3-nitrophenyl)formamide |
| InChIKey | QCDUUALALDXTAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC=O |
Computed by PubChem (NCBI)