3-Nitrophthalic acid, 98%
cas: 603-11-2 — see every product listed under this CAS number, including other names
3-Nitrophthalic acid, 98% (CAS 603-11-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg, 25g, 5kg, 10kg, 25kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A320154-100g |
| cas | 603-11-2 |
| size | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 175.69 Pln | |
| Ambeed | 500g | 420.44 Pln | |
| Ambeed | 1kg | 654.06 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 78.80 Pln | |
| Chemat | 500g | 192.00 Pln | |
| Chemat | 1kg | 261.20 Pln | |
| Chemat | 5kg | 1608.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 208.84 Pln | |
| BLDpharm | 500g | 236.61 Pln | |
| BLDpharm | 1kg | 269.93 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-nitrophthalic acid (CAS 603-11-2) is a chemical compound with the molecular formula C8H5NO6 and a molecular weight of 211.13 g/mol. IUPAC name: 3-nitrophthalic acid. InChIKey: KFIRODWJCYBBHY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO6 |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 3-nitrophthalic acid |
| InChIKey | KFIRODWJCYBBHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)