CAS 1094107-96-6 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2H-1,4-benzothiazine-7-carboxylic acid, 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-7-carboxylic acid, 95%, 95%, 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-7-carboxylic acid, 97%, 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-7-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
3-oxo-4H-1,4-benzothiazine-7-carboxylic acid (CAS 1094107-96-6) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 3-oxo-4H-1,4-benzothiazine-7-carboxylic acid. InChIKey: PMIQHWMFUZMWOX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzothiazine-7-carboxylic acid |
| InChIKey | PMIQHWMFUZMWOX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)