CAS 1243101-05-4 appears in our catalog under these names: 2-(4-Oxothieno[3,2-c]pyridin-5(4h)-yl)acetic acid, 95%, 2-(4-Oxothieno(3,2-c)pyridin-5(4H)-yl)acetic acid, 95+%, 2–(4–Oxothieno(3,2–c)pyridin–5(4H)–yl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(4-oxothieno[3,2-c]pyridin-5-yl)acetic acid (CAS 1243101-05-4) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 2-(4-oxothieno[3,2-c]pyridin-5-yl)acetic acid. InChIKey: XFDQPDDFFGWKQR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 2-(4-oxothieno[3,2-c]pyridin-5-yl)acetic acid |
| InChIKey | XFDQPDDFFGWKQR-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C2=C1SC=C2)CC(=O)O |
Computed by PubChem (NCBI)