cas: 1204-75-7 — see every product listed under this CAS number, including other names
3-Oxo-3,4-dihydroquinoxaline-2-carboxylic acid 95% (CAS 1204-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A212541-1g |
| cas | 1204-75-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 904.38 Pln | |
| Ambeed | 25g | 2773.38 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 10g | 1488.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A212541 |
3-oxo-4H-quinoxaline-2-carboxylic acid (CAS 1204-75-7) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-oxo-4H-quinoxaline-2-carboxylic acid. InChIKey: NMOWGWOAPRKWIR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-oxo-4H-quinoxaline-2-carboxylic acid |
| InChIKey | NMOWGWOAPRKWIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(=N2)C(=O)O |
Computed by PubChem (NCBI)