cas: 1204-75-7 — see every product listed under this CAS number, including other names
3-Oxo-3,4-dihydroquinoxaline-2-carboxylic acid, 95%, 95% (CAS 1204-75-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JUP-25g |
| cas | 1204-75-7 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 947.60 Pln | |
| Chemat | 10g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-oxo-4H-quinoxaline-2-carboxylic acid (CAS 1204-75-7) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-oxo-4H-quinoxaline-2-carboxylic acid. InChIKey: NMOWGWOAPRKWIR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-oxo-4H-quinoxaline-2-carboxylic acid |
| InChIKey | NMOWGWOAPRKWIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C(=N2)C(=O)O |
Computed by PubChem (NCBI)