3-Phenylisoquinoline, 95%
cas: 37993-76-3 — see every product listed under this CAS number, including other names
3-Phenylisoquinoline, 95% (CAS 37993-76-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A437632-250mg |
| cas | 37993-76-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 1043.44 Pln | |
| Ambeed | 5g | 3518.75 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1119.63 Pln | |
| BLDpharm | 5g | 3790.91 Pln | |
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 1893.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-phenylisoquinoline (CAS 37993-76-3) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 3-phenylisoquinoline. InChIKey: RBJOTRVJJWIIER-UHFFFAOYSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-phenylisoquinoline |
| InChIKey | RBJOTRVJJWIIER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C=N2 |
Computed by PubChem (NCBI)