CAS 605-03-8 appears in our catalog under these names: 4-Phenylquinoline, 95-<97%, 4–Phenylquinoline, 4-Phenylquinoline 95%, 4-Phenylquinoline, 98%, 98%, 4-Phenylquinoline, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 200g, 100mg, 250mg.
4-phenylquinoline (CAS 605-03-8) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 4-phenylquinoline. InChIKey: LOCUXGFHUYBUHF-UHFFFAOYSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 4-phenylquinoline |
| InChIKey | LOCUXGFHUYBUHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=NC3=CC=CC=C23 |
Computed by PubChem (NCBI)