CAS 13041-79-7 appears in our catalog under these names: 4-Cyanostilbene, 95%, 4–Cyano–trans–stilbene, 4-Cyano-trans-stilbene, >96.0%(GC), (E)-4-styrylbenzonitrile, 98%, 98%, (E)-4-styrylbenzonitrile, 96%,RG. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg, 5g.
4-[(E)-2-phenylethenyl]benzonitrile (CAS 13041-79-7) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 4-[(E)-2-phenylethenyl]benzonitrile. InChIKey: WQUHPLQCUQJSQW-VOTSOKGWSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 4-[(E)-2-phenylethenyl]benzonitrile |
| InChIKey | WQUHPLQCUQJSQW-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)