Products 1666-96-2
CAS 1666-96-2 is the registry number for 3-Phenylquinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
3-phenylquinoline (CAS 1666-96-2) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 3-phenylquinoline. InChIKey: ZPKRDBXIPFYPTF-UHFFFAOYSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-phenylquinoline |
| InChIKey | ZPKRDBXIPFYPTF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)