Products 612-95-3
CAS 612-95-3 appears in our catalog under these names: 6-Phenylquinoline, 95%, 6-Phenylquinoline, 95-<97%, 6-Phenylquinoline, ≥97-<99%, 6–phenylquinoline, 6-Phenylquinoline, 97%, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2,5g, 5g, 10g.
6-phenylquinoline (CAS 612-95-3) is a chemical compound with the molecular formula C15H11N and a molecular weight of 205.25 g/mol. IUPAC name: 6-phenylquinoline. InChIKey: OKLKICXAGRLLGF-UHFFFAOYSA-N.
| Molecular formula | C15H11N |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 6-phenylquinoline |
| InChIKey | OKLKICXAGRLLGF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)