CAS 103863-15-6 appears in our catalog under these names: 3-Phenylpyridine-2-carboxylic acid, 3-Phenylpicolinic acid, 96%, 96%, 3-Phenylpyridine-2-carboxylic acid, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5000mg, 250mg, 1g.
3-phenylpyridine-2-carboxylic acid (CAS 103863-15-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 3-phenylpyridine-2-carboxylic acid. InChIKey: SJLPJJGKJSOUOR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 3-phenylpyridine-2-carboxylic acid |
| InChIKey | SJLPJJGKJSOUOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC=C2)C(=O)O |
Computed by PubChem (NCBI)