cas: 41270-67-1 — see every product listed under this CAS number, including other names
3-Phenylpyrazin-2-amine 95% (CAS 41270-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A203276-100mg |
| cas | 41270-67-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1399.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A203276 |
3-phenylpyrazin-2-amine (CAS 41270-67-1) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 3-phenylpyrazin-2-amine. InChIKey: HZNLSEFDJFDNFU-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 3-phenylpyrazin-2-amine |
| InChIKey | HZNLSEFDJFDNFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CN=C2N |
Computed by PubChem (NCBI)