cas: 850568-78-4 — see every product listed under this CAS number, including other names
3-Propoxycarbonylphenylboronic acid 98% (CAS 850568-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119780-1g |
| cas | 850568-78-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 25g | 470.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A119780 |
(3-propoxycarbonylphenyl)boronic acid (CAS 850568-78-4) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (3-propoxycarbonylphenyl)boronic acid. InChIKey: BSCFVVVAJINDLA-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (3-propoxycarbonylphenyl)boronic acid |
| InChIKey | BSCFVVVAJINDLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OCCC)(O)O |
Computed by PubChem (NCBI)