cas: 154257-78-0 — see every product listed under this CAS number, including other names
3-bromo-2-chloro-5-methylbenzoic acid, 98% (CAS 154257-78-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1272178-250mg |
| cas | 154257-78-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 2016.49 Pln | |
| AmBeed | 25g | 58549.33 Pln | |
| AmBeed | 10g | 29859.76 Pln | |
| AmBeed | 5g | 17588.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-2-chloro-5-methylbenzoic acid (CAS 154257-78-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 3-bromo-2-chloro-5-methylbenzoic acid. InChIKey: WWBCWHSPJLLRAB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 3-bromo-2-chloro-5-methylbenzoic acid |
| InChIKey | WWBCWHSPJLLRAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)