3-tert-Butoxycarbonylamino-hexanoic acid, 95%, 95%
cas: 282524-95-2 — see every product listed under this CAS number, including other names
3-tert-Butoxycarbonylamino-hexanoic acid, 95%, 95% (CAS 282524-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BE2W-100mg |
| cas | 282524-95-2 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1096.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 282524-95-2) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: WTYLEXCGLNFFIN-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | WTYLEXCGLNFFIN-UHFFFAOYSA-N |
| SMILES | CCCC(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
3-tert-Butoxycarbonylamino-hexanoic acid, 3-((tert-Butoxycarbonyl)amino)hexanoic acid, 3-tert-Butoxycarbonylaminohexanoic acid, n-boc-3-aminohexanoic acid, 3-[(tert-butoxycarbonyl)amino]hexanoic acid, 3-{[(tert-butoxy)carbonyl]amino}hexanoic acid, 3-(tert-butoxycarbonylamino)hexanoic acid, 3-[[(1,1-Dimethylethoxy)carbonyl]amino]hexanoic acid, 3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid