cas: 798-61-8 — see every product listed under this CAS number, including other names
4',6,7-Trimethoxyisoflavone (CAS 798-61-8) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G561-200mg |
| cas | 798-61-8 |
| size | 200mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 208.40 Pln | |
| Chemat | 1g | 506.00 Pln |
| delivery time | 3 weeks |
|---|
6,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one (CAS 798-61-8) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 6,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one. InChIKey: YHXIOAVHEXKZCQ-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 6,7-dimethoxy-3-(4-methoxyphenyl)chromen-4-one |
| InChIKey | YHXIOAVHEXKZCQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=C(C=C3C2=O)OC)OC |
Computed by PubChem (NCBI)