CAS 119568-10-4 is the registry number for (E)-4-(3-(3,4-Dimethoxyphenyl)-3-oxoprop-1-en-1-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzoic acid (CAS 119568-10-4) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: OLYUYUJVNSXGGP-WEVVVXLNSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 4-[(E)-3-(3,4-dimethoxyphenyl)-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | OLYUYUJVNSXGGP-WEVVVXLNSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(=O)O)OC |
Computed by PubChem (NCBI)