Products 664366-23-8
CAS 664366-23-8 is the registry number for 2-(4-Methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetic acid (CAS 664366-23-8) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetic acid. InChIKey: JGPAHLCOHGAHAD-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-3-yl)acetic acid |
| InChIKey | JGPAHLCOHGAHAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=CC3=C(C=C12)C4=C(O3)CCCC4)CC(=O)O |
Computed by PubChem (NCBI)