cas: 343604-24-0 — see every product listed under this CAS number, including other names
4'-(Trifluoromethyl)-[1,1'-biphenyl]-3-carbaldehyde 97% (CAS 343604-24-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A366583-250mg |
| cas | 343604-24-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 342.56 Pln | |
| Ambeed | 25g | 1416.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A366583 |
3-[4-(trifluoromethyl)phenyl]benzaldehyde (CAS 343604-24-0) is a chemical compound with the molecular formula C14H9F3O and a molecular weight of 250.21 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]benzaldehyde. InChIKey: JLQBHCYLEQJWCE-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O |
|---|---|
| Molecular weight | 250.21 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]benzaldehyde |
| InChIKey | JLQBHCYLEQJWCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=C(C=C2)C(F)(F)F)C=O |
Computed by PubChem (NCBI)