Products 2719-21-3
CAS 2719-21-3 appears in our catalog under these names: 4'–Acetamidoacetophenone, 4-Acetamidoacetophenone/ 98%, 4'-Acetamidoacetophenone, 98% , 4-Acetylacetanilide, 4'-Acetamidoacetophenone, >98.0%(GC). Offered by: GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 25g, 250g, 50g, 10g, 0,1kg, 0,25kg, 5g, 100g.
N-(4-acetylphenyl)acetamide (CAS 2719-21-3) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(4-acetylphenyl)acetamide. InChIKey: WECHHDJTILFYQT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(4-acetylphenyl)acetamide |
| InChIKey | WECHHDJTILFYQT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)