cas: 2627-77-2 — see every product listed under this CAS number, including other names
4'-Bromosalicylanilide, >98.0%(T)(HPLC) (CAS 2627-77-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0919-5G |
| cas | 2627-77-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 865.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(HPLC) |
N-(4-bromophenyl)-2-hydroxybenzamide (CAS 2627-77-2) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: N-(4-bromophenyl)-2-hydroxybenzamide. InChIKey: DKQMTUHJJPFJRL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-hydroxybenzamide |
| InChIKey | DKQMTUHJJPFJRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)