cas: 2627-77-2 — see every product listed under this CAS number, including other names
N-(4-Bromophenyl)-2-hydroxybenzamide (CAS 2627-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SJD-1g |
| cas | 2627-77-2 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1077.20 Pln |
| delivery time | 3 weeks |
|---|
N-(4-bromophenyl)-2-hydroxybenzamide (CAS 2627-77-2) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: N-(4-bromophenyl)-2-hydroxybenzamide. InChIKey: DKQMTUHJJPFJRL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-hydroxybenzamide |
| InChIKey | DKQMTUHJJPFJRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)