cas: 2627-77-2 — see every product listed under this CAS number, including other names
N-(4-Bromophenyl)-2-hydroxybenzamide, 95+% (CAS 2627-77-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A456921-1g |
| cas | 2627-77-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2140.18 Pln | |
| AmBeed | 250mg | 1235.29 Pln | |
| AmBeed | 10g | 13356.91 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-(4-bromophenyl)-2-hydroxybenzamide (CAS 2627-77-2) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: N-(4-bromophenyl)-2-hydroxybenzamide. InChIKey: DKQMTUHJJPFJRL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-hydroxybenzamide |
| InChIKey | DKQMTUHJJPFJRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)