cas: 20443-74-7 — see every product listed under this CAS number, including other names
4'-Chloro[1,1'-biphenyl]-4-sulfonyl chloride, 97% (CAS 20443-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO07005DA |
| cas | 20443-74-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 184.80 Pln | |
| Thermo Scientific | 10g | 1491.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(4-chlorophenyl)benzenesulfonyl chloride (CAS 20443-74-7) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-(4-chlorophenyl)benzenesulfonyl chloride. InChIKey: NWYUSJMIHFIMTA-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | NWYUSJMIHFIMTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)