cas: 20443-74-7 — see every product listed under this CAS number, including other names
4′–Chlorobiphenyl–4–sulfonyl chloride (CAS 20443-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD07355-1g |
| cas | 20443-74-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 756.18 Pln | |
| GLPBio | 250mg | 536.19 Pln | |
| GLPBio | 5g | 1790.57 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-chlorophenyl)benzenesulfonyl chloride (CAS 20443-74-7) is a chemical compound with the molecular formula C12H8Cl2O2S and a molecular weight of 287.2 g/mol. IUPAC name: 4-(4-chlorophenyl)benzenesulfonyl chloride. InChIKey: NWYUSJMIHFIMTA-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O2S |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 4-(4-chlorophenyl)benzenesulfonyl chloride |
| InChIKey | NWYUSJMIHFIMTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)